C22H27NO5 — CID 163106408
[(1R,5S,8R,9S,10R,11R,14R,16R,17R,18R,19R)-16,19-dihydroxy-5-methyl-12-methylidene-3-oxo-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-10-yl] acetate (PubChem CID 163106408) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is [(1R,5S,8R,9S,10R,11R,14R,16R,17R,18R,19R)-16,19-dihydroxy-5-methyl-12-methylidene-3-oxo-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-10-yl] acetate.
| Compound Name | [(1R,5S,8R,9S,10R,11R,14R,16R,17R,18R,19R)-16,19-dihydroxy-5-methyl-12-methylidene-3-oxo-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-10-yl] acetate |
|---|---|
| PubChem CID | 163106408 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | [(1R,5S,8R,9S,10R,11R,14R,16R,17R,18R,19R)-16,19-dihydroxy-5-methyl-12-methylidene-3-oxo-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-10-yl] acetate |
| SMILES | C=C1C[C@@]23C[C@@]4(O)[C@@H]5[C@]6(C)CC(=O)C[C@@]57[C@@H]2[C@@H](O)[C@@H]1[C@H](OC(C)=O)[C@@H]3[C@H]7N4C6 |
| InChI | InChI=1S/C22H27NO5/c1-9-4-20-7-22(27)18-19(3)5-11(25)6-21(18)16(20)14(26)12(9)15(28-10(2)24)13(20)17(21)23(22)8-19/h12-18,26-27H,1,4-8H2,2-3H3/t12-,13-,14+,15+,16-,17-,18-,19-,20+,21+,22-/m1/s1 |
| InChIKey | WHEBPXWXKIGYGW-DHOPKAKSSA-N |
| XLogP | 0.86 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|