C22H27NO5 — CID 162986341
(3,16-dihydroxy-5-methyl-12-methylidene-10-oxo-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-2-yl) acetate (PubChem CID 162986341) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is (3,16-dihydroxy-5-methyl-12-methylidene-10-oxo-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-2-yl) acetate.
| Compound Name | (3,16-dihydroxy-5-methyl-12-methylidene-10-oxo-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-2-yl) acetate |
|---|---|
| PubChem CID | 162986341 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | (3,16-dihydroxy-5-methyl-12-methylidene-10-oxo-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-2-yl) acetate |
| SMILES | C=C1CC23CC4(O)C5C6(C)CC(O)C(OC(C)=O)C57C(C2C(=O)C1CC37)N4C6 |
| InChI | InChI=1S/C22H27NO5/c1-9-5-20-7-21(27)18-19(3)6-12(25)17(28-10(2)24)22(18)13(20)4-11(9)15(26)14(20)16(22)23(21)8-19/h11-14,16-18,25,27H,1,4-8H2,2-3H3 |
| InChIKey | SMKLDHHGRDTUQJ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|