C24H33NO5 — CID 22210236
[(1R,5R,9S,11S,16R,17R,18S)-11,16,19-trihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-13-yl] 2-methylpropanoate (PubChem CID 22210236) has the molecular formula C24H33NO5 and a molecular weight of 415.53 g/mol. Its IUPAC name is [(1R,5R,9S,11S,16R,17R,18S)-11,16,19-trihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-13-yl] 2-methylpropanoate.
| Compound Name | [(1R,5R,9S,11S,16R,17R,18S)-11,16,19-trihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-13-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 22210236 |
| Molecular Formula | C24H33NO5 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | [(1R,5R,9S,11S,16R,17R,18S)-11,16,19-trihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-13-yl] 2-methylpropanoate |
| SMILES | C=C1C(OC(=O)C(C)C)C23C[C@@]4(O)[C@@H]5[C@@]6(C)CCC[C@]57C([C@H]2C[C@@]1(O)C(O)[C@H]37)N4C6 |
| InChI | InChI=1S/C24H33NO5/c1-11(2)18(27)30-17-12(3)23(28)8-13-15-21-7-5-6-20(4)10-25(15)24(29,19(20)21)9-22(13,17)14(21)16(23)26/h11,13-17,19,26,28-29H,3,5-10H2,1-2,4H3/t13-,14+,15?,16?,17?,19-,20+,21+,22?,23+,24-/m1/s1 |
| InChIKey | XSDJVVZNKHIOBC-XSRXZDJFSA-N |
| XLogP | 1.43 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|