C22H29NO4 — CID 162940343
[(1S,5R,8R,9S,11R,13R,14S,15S,16R,17R,18S,19R)-13,15-dihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-19-yl] acetate (PubChem CID 162940343) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is [(1S,5R,8R,9S,11R,13R,14S,15S,16R,17R,18S,19R)-13,15-dihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-19-yl] acetate.
| Compound Name | [(1S,5R,8R,9S,11R,13R,14S,15S,16R,17R,18S,19R)-13,15-dihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-19-yl] acetate |
|---|---|
| PubChem CID | 162940343 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | [(1S,5R,8R,9S,11R,13R,14S,15S,16R,17R,18S,19R)-13,15-dihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-19-yl] acetate |
| SMILES | C=C1[C@H]2C[C@@H]3[C@H]4N5C[C@]6(C)CCC[C@@]47[C@@H]6[C@@H]5[C@@H](O)[C@]3([C@@H]1O)[C@H]7[C@@H]2OC(C)=O |
| InChI | InChI=1S/C22H29NO4/c1-9-11-7-12-17-21-6-4-5-20(3)8-23(17)13(15(20)21)19(26)22(12,18(9)25)16(21)14(11)27-10(2)24/h11-19,25-26H,1,4-8H2,2-3H3/t11-,12-,13-,14-,15-,16+,17-,18-,19-,20+,21+,22+/m1/s1 |
| InChIKey | RINGSRWVMFQHRI-UBUXLEJNSA-N |
| XLogP | 1.33 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|