C28H30F3NO3 — CID 118727737
[(1S,5R,9S,11R,13R,14R,16S,17R,18S,19S)-13-hydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-19-yl] 2-(trifluoromethyl)benzoate (PubChem CID 118727737) has the molecular formula C28H30F3NO3 and a molecular weight of 485.55 g/mol. Its IUPAC name is [(1S,5R,9S,11R,13R,14R,16S,17R,18S,19S)-13-hydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-19-yl] 2-(trifluoromethyl)benzoate.
| Compound Name | [(1S,5R,9S,11R,13R,14R,16S,17R,18S,19S)-13-hydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-19-yl] 2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 118727737 |
| Molecular Formula | C28H30F3NO3 |
| Molecular Weight | 485.55 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | [(1S,5R,9S,11R,13R,14R,16S,17R,18S,19S)-13-hydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-19-yl] 2-(trifluoromethyl)benzoate |
| SMILES | C=C1[C@H]2C[C@@H]3C4N5C[C@]6(C)CCC[C@@]47[C@@H]6[C@@H]5C[C@]3([C@@H]1O)[C@H]7[C@H]2OC(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C28H30F3NO3/c1-13-15-10-17-22-26-9-5-8-25(2)12-32(22)18(20(25)26)11-27(17,23(13)33)21(26)19(15)35-24(34)14-6-3-4-7-16(14)28(29,30)31/h3-4,6-7,15,17-23,33H,1,5,8-12H2,2H3/t15-,17-,18+,19+,20-,21+,22?,23-,25+,26+,27-/m1/s1 |
| InChIKey | FZDBTZZHQLCNGK-CYJNUAPISA-N |
| XLogP | 4.68 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|