C19H25NO — CID 134939651
(8R,9S,14S,16R,17R)-5-methyl-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-12-one (PubChem CID 134939651) has the molecular formula C19H25NO and a molecular weight of 283.41 g/mol. Its IUPAC name is (8R,9S,14S,16R,17R)-5-methyl-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-12-one.
| Compound Name | (8R,9S,14S,16R,17R)-5-methyl-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-12-one |
|---|---|
| PubChem CID | 134939651 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | (8R,9S,14S,16R,17R)-5-methyl-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-12-one |
| SMILES | CC12CCCC34C5CC6C[C@@H]7[C@H]3N(C1)[C@H](C[C@]57CC6=O)[C@H]24 |
| InChI | InChI=1S/C19H25NO/c1-17-3-2-4-19-14-6-10-5-11-16(19)20(9-17)12(15(17)19)7-18(11,14)8-13(10)21/h10-12,14-16H,2-9H2,1H3/t10?,11-,12-,14?,15-,16-,17?,18-,19?/m1/s1 |
| InChIKey | YJLVKWRVQSZKHC-TZOYIYMRSA-N |
| XLogP | 2.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |