C22H33NO3 — CID 163100142
(1R,5R,8R,9R,11R,12S,14R,17S,18R)-12-hydroxy-7-(2-hydroxyethyl)-5,12-dimethyl-7-azahexacyclo[9.6.2.01,8.05,17.09,14.014,18]nonadecan-16-one (PubChem CID 163100142) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is (1R,5R,8R,9R,11R,12S,14R,17S,18R)-12-hydroxy-7-(2-hydroxyethyl)-5,12-dimethyl-7-azahexacyclo[9.6.2.01,8.05,17.09,14.014,18]nonadecan-16-one.
| Compound Name | (1R,5R,8R,9R,11R,12S,14R,17S,18R)-12-hydroxy-7-(2-hydroxyethyl)-5,12-dimethyl-7-azahexacyclo[9.6.2.01,8.05,17.09,14.014,18]nonadecan-16-one |
|---|---|
| PubChem CID | 163100142 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | (1R,5R,8R,9R,11R,12S,14R,17S,18R)-12-hydroxy-7-(2-hydroxyethyl)-5,12-dimethyl-7-azahexacyclo[9.6.2.01,8.05,17.09,14.014,18]nonadecan-16-one |
| SMILES | C[C@]12CCC[C@]34[C@@H]5C[C@@H]6C[C@@H]([C@H]3N(CCO)C1)[C@@]5(CC(=O)[C@@H]24)C[C@]6(C)O |
| InChI | InChI=1S/C22H33NO3/c1-19-4-3-5-22-16-9-13-8-14(18(22)23(12-19)6-7-24)21(16,11-20(13,2)26)10-15(25)17(19)22/h13-14,16-18,24,26H,3-12H2,1-2H3/t13-,14-,16+,17-,18+,19-,20-,21+,22+/m0/s1 |
| InChIKey | VECNWVPULQDULP-FGHIYSTCSA-N |
| XLogP | 2.23 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |