C22H31NO3 — CID 163066046
(1R,5R,6R,11R,12R,14R,15S,17R,20R,21R)-15-hydroxy-5,15-dimethyl-7-oxa-10-azaheptacyclo[12.6.2.01,11.05,20.06,10.012,17.017,21]docosan-19-one (PubChem CID 163066046) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is (1R,5R,6R,11R,12R,14R,15S,17R,20R,21R)-15-hydroxy-5,15-dimethyl-7-oxa-10-azaheptacyclo[12.6.2.01,11.05,20.06,10.012,17.017,21]docosan-19-one.
| Compound Name | (1R,5R,6R,11R,12R,14R,15S,17R,20R,21R)-15-hydroxy-5,15-dimethyl-7-oxa-10-azaheptacyclo[12.6.2.01,11.05,20.06,10.012,17.017,21]docosan-19-one |
|---|---|
| PubChem CID | 163066046 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | (1R,5R,6R,11R,12R,14R,15S,17R,20R,21R)-15-hydroxy-5,15-dimethyl-7-oxa-10-azaheptacyclo[12.6.2.01,11.05,20.06,10.012,17.017,21]docosan-19-one |
| SMILES | C[C@]12CCC[C@]34[C@@H]5C[C@@H]6C[C@@H]([C@H]3N3CCO[C@@H]31)[C@@]5(CC(=O)[C@@H]24)C[C@]6(C)O |
| InChI | InChI=1S/C22H31NO3/c1-19-4-3-5-22-15-9-12-8-13(17(22)23-6-7-26-18(19)23)21(15,11-20(12,2)25)10-14(24)16(19)22/h12-13,15-18,25H,3-11H2,1-2H3/t12-,13-,15+,16-,17+,18+,19+,20-,21+,22+/m0/s1 |
| InChIKey | ADWWSTLDHHDKTM-OMIWIDRMSA-N |
| XLogP | 2.59 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |