C24H35NO5 — CID 163013941
[(1S,2R,4S,5S,7R,8R,12R,13S,18R,20S,21R)-4-hydroxy-4,12-dimethyl-14,19-dioxa-17-azaheptacyclo[10.7.2.22,5.02,7.08,18.08,21.013,17]tricosan-20-yl] acetate (PubChem CID 163013941) has the molecular formula C24H35NO5 and a molecular weight of 417.55 g/mol. Its IUPAC name is [(1S,2R,4S,5S,7R,8R,12R,13S,18R,20S,21R)-4-hydroxy-4,12-dimethyl-14,19-dioxa-17-azaheptacyclo[10.7.2.22,5.02,7.08,18.08,21.013,17]tricosan-20-yl] acetate.
| Compound Name | [(1S,2R,4S,5S,7R,8R,12R,13S,18R,20S,21R)-4-hydroxy-4,12-dimethyl-14,19-dioxa-17-azaheptacyclo[10.7.2.22,5.02,7.08,18.08,21.013,17]tricosan-20-yl] acetate |
|---|---|
| PubChem CID | 163013941 |
| Molecular Formula | C24H35NO5 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | [(1S,2R,4S,5S,7R,8R,12R,13S,18R,20S,21R)-4-hydroxy-4,12-dimethyl-14,19-dioxa-17-azaheptacyclo[10.7.2.22,5.02,7.08,18.08,21.013,17]tricosan-20-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H]2O[C@H]3N4CCO[C@H]4[C@]4(C)CCC[C@]3([C@H]14)[C@@H]1C[C@@H]3CC[C@]21C[C@]3(C)O |
| InChI | InChI=1S/C24H35NO5/c1-13(26)29-16-17-21(2)6-4-7-24(17)15-11-14-5-8-23(15,12-22(14,3)27)18(16)30-20(24)25-9-10-28-19(21)25/h14-20,27H,4-12H2,1-3H3/t14-,15+,16-,17+,18+,19-,20+,21+,22-,23+,24+/m0/s1 |
| InChIKey | ZVGHBOHWOUTHNI-UXEFBJKRSA-N |
| XLogP | 2.68 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |