C24H33NO5 — CID 10811800
[(1R,5R,8S,10S,11R,14S,17S,18S)-7-(2-hydroxyethyl)-5-methyl-13-methylidene-6-oxo-9-oxa-7-azahexacyclo[8.6.2.211,14.01,8.05,17.011,16]icosan-18-yl] acetate (PubChem CID 10811800) has the molecular formula C24H33NO5 and a molecular weight of 415.53 g/mol. Its IUPAC name is [(1R,5R,8S,10S,11R,14S,17S,18S)-7-(2-hydroxyethyl)-5-methyl-13-methylidene-6-oxo-9-oxa-7-azahexacyclo[8.6.2.211,14.01,8.05,17.011,16]icosan-18-yl] acetate.
| Compound Name | [(1R,5R,8S,10S,11R,14S,17S,18S)-7-(2-hydroxyethyl)-5-methyl-13-methylidene-6-oxo-9-oxa-7-azahexacyclo[8.6.2.211,14.01,8.05,17.011,16]icosan-18-yl] acetate |
|---|---|
| PubChem CID | 10811800 |
| Molecular Formula | C24H33NO5 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | [(1R,5R,8S,10S,11R,14S,17S,18S)-7-(2-hydroxyethyl)-5-methyl-13-methylidene-6-oxo-9-oxa-7-azahexacyclo[8.6.2.211,14.01,8.05,17.011,16]icosan-18-yl] acetate |
| SMILES | C=C1C[C@]23CC[C@H]1CC2[C@@]12CCC[C@@]4(C)C(=O)N(CCO)[C@H]1O[C@@H]3[C@@H](OC(C)=O)[C@@H]24 |
| InChI | InChI=1S/C24H33NO5/c1-13-12-23-8-5-15(13)11-16(23)24-7-4-6-22(3)18(24)17(29-14(2)27)19(23)30-21(24)25(9-10-26)20(22)28/h15-19,21,26H,1,4-12H2,2-3H3/t15-,16?,17-,18+,19+,21-,22+,23+,24+/m0/s1 |
| InChIKey | DHBPYVIHAQUSGZ-DVJXFVDWSA-N |
| XLogP | 2.65 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|