C29H33NO5 — CID 177403275
[(1S,5R,8R,9S,11R,13R,14R,16S,17R,18S)-5-methyl-12-methylidene-19-oxo-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-13-yl] 3,4-dimethoxybenzoate (PubChem CID 177403275) has the molecular formula C29H33NO5 and a molecular weight of 475.59 g/mol. Its IUPAC name is [(1S,5R,8R,9S,11R,13R,14R,16S,17R,18S)-5-methyl-12-methylidene-19-oxo-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-13-yl] 3,4-dimethoxybenzoate.
| Compound Name | [(1S,5R,8R,9S,11R,13R,14R,16S,17R,18S)-5-methyl-12-methylidene-19-oxo-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-13-yl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 177403275 |
| Molecular Formula | C29H33NO5 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | [(1S,5R,8R,9S,11R,13R,14R,16S,17R,18S)-5-methyl-12-methylidene-19-oxo-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-13-yl] 3,4-dimethoxybenzoate |
| SMILES | C=C1[C@H]2C[C@@H]3[C@H]4N5C[C@]6(C)CCC[C@]47[C@H](C2=O)[C@]3(C[C@H]5[C@H]67)[C@@H]1OC(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C29H33NO5/c1-14-16-11-17-24-28-9-5-8-27(2)13-30(24)18(22(27)28)12-29(17,23(28)21(16)31)25(14)35-26(32)15-6-7-19(33-3)20(10-15)34-4/h6-7,10,16-18,22-25H,1,5,8-9,11-13H2,2-4H3/t16-,17-,18+,22-,23+,24-,25-,27+,28+,29-/m1/s1 |
| InChIKey | VUNGSOASTCDBLI-YNLKYNPXSA-N |
| XLogP | 3.88 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|