C30H37NO6 — CID 101028059
[(1R,5R,8R,9S,11R,13R,14R,17R,18S,19S)-19-hydroxy-5,7-dimethyl-12-methylidene-16-oxo-7-azahexacyclo[9.6.2.01,8.05,17.09,14.014,18]nonadecan-13-yl] 3,4-dimethoxybenzoate (PubChem CID 101028059) has the molecular formula C30H37NO6 and a molecular weight of 507.63 g/mol. Its IUPAC name is [(1R,5R,8R,9S,11R,13R,14R,17R,18S,19S)-19-hydroxy-5,7-dimethyl-12-methylidene-16-oxo-7-azahexacyclo[9.6.2.01,8.05,17.09,14.014,18]nonadecan-13-yl] 3,4-dimethoxybenzoate.
| Compound Name | [(1R,5R,8R,9S,11R,13R,14R,17R,18S,19S)-19-hydroxy-5,7-dimethyl-12-methylidene-16-oxo-7-azahexacyclo[9.6.2.01,8.05,17.09,14.014,18]nonadecan-13-yl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 101028059 |
| Molecular Formula | C30H37NO6 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | [(1R,5R,8R,9S,11R,13R,14R,17R,18S,19S)-19-hydroxy-5,7-dimethyl-12-methylidene-16-oxo-7-azahexacyclo[9.6.2.01,8.05,17.09,14.014,18]nonadecan-13-yl] 3,4-dimethoxybenzoate |
| SMILES | C=C1[C@H]2C[C@@H]3[C@H]4N(C)C[C@]5(C)CCC[C@]46[C@H]([C@H]2O)[C@]3(CC(=O)[C@H]56)[C@@H]1OC(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C30H37NO6/c1-15-17-12-18-25-29-10-6-9-28(2,14-31(25)3)23(29)19(32)13-30(18,24(29)22(17)33)26(15)37-27(34)16-7-8-20(35-4)21(11-16)36-5/h7-8,11,17-18,22-26,33H,1,6,9-10,12-14H2,2-5H3/t17-,18-,22+,23-,24+,25-,26-,28+,29+,30-/m1/s1 |
| InChIKey | LPMFHFNQVYSASY-DRLAKMKISA-N |
| XLogP | 3.49 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|