C27H31NO4 — CID 138402287
[(5R,9S,11S,15S,16S,17R,18R)-2,15-dihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-10-yl] benzoate (PubChem CID 138402287) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is [(5R,9S,11S,15S,16S,17R,18R)-2,15-dihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-10-yl] benzoate.
| Compound Name | [(5R,9S,11S,15S,16S,17R,18R)-2,15-dihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-10-yl] benzoate |
|---|---|
| PubChem CID | 138402287 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | [(5R,9S,11S,15S,16S,17R,18R)-2,15-dihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-10-yl] benzoate |
| SMILES | C=C1CC23[C@@H]4C(OC(=O)c5ccccc5)[C@H]1C[C@H]2C12C(O)CC[C@@]5(C)CN(C41)[C@H]([C@H]3O)[C@@H]25 |
| InChI | InChI=1S/C27H31NO4/c1-13-11-26-16-10-15(13)20(32-24(31)14-6-4-3-5-7-14)18(26)22-27(16)17(29)8-9-25(2)12-28(22)19(21(25)27)23(26)30/h3-7,15-23,29-30H,1,8-12H2,2H3/t15-,16+,17?,18+,19-,20?,21+,22?,23+,25-,26?,27?/m0/s1 |
| InChIKey | PVXMEZPXMNKCAW-UHKFPBKBSA-N |
| XLogP | 2.63 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|