C27H31NO4 — CID 163104096
[(1R,3S,5S,8R,9S,11S,13R,14S,16S,17R,18R)-13,18-dihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-3-yl] benzoate (PubChem CID 163104096) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is [(1R,3S,5S,8R,9S,11S,13R,14S,16S,17R,18R)-13,18-dihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-3-yl] benzoate.
| Compound Name | [(1R,3S,5S,8R,9S,11S,13R,14S,16S,17R,18R)-13,18-dihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-3-yl] benzoate |
|---|---|
| PubChem CID | 163104096 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | [(1R,3S,5S,8R,9S,11S,13R,14S,16S,17R,18R)-13,18-dihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-3-yl] benzoate |
| SMILES | C=C1[C@H]2C[C@@H]3[C@H]4N5C[C@@]6(C)C[C@H](OC(=O)c7ccccc7)C[C@@]47[C@@H]6[C@@H]5C[C@]3([C@@H]1O)[C@@]7(O)C2 |
| InChI | InChI=1S/C27H31NO4/c1-14-16-8-18-21-26-11-17(32-23(30)15-6-4-3-5-7-15)10-24(2)13-28(21)19(20(24)26)12-25(18,22(14)29)27(26,31)9-16/h3-7,16-22,29,31H,1,8-13H2,2H3/t16-,17-,18+,19-,20+,21+,22+,24+,25-,26+,27-/m0/s1 |
| InChIKey | GDVVPFXWAZSXGV-PDKOAVJDSA-N |
| XLogP | 2.77 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|