C23H29NO3 — CID 162895911
[(1S,2S,4R,8S,10S,11R,13R,15R)-11-hydroxy-15-methyl-6-azapentacyclo[8.6.0.01,6.02,13.04,10]hexadecan-8-yl] benzoate (PubChem CID 162895911) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is [(1S,2S,4R,8S,10S,11R,13R,15R)-11-hydroxy-15-methyl-6-azapentacyclo[8.6.0.01,6.02,13.04,10]hexadecan-8-yl] benzoate.
| Compound Name | [(1S,2S,4R,8S,10S,11R,13R,15R)-11-hydroxy-15-methyl-6-azapentacyclo[8.6.0.01,6.02,13.04,10]hexadecan-8-yl] benzoate |
|---|---|
| PubChem CID | 162895911 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | [(1S,2S,4R,8S,10S,11R,13R,15R)-11-hydroxy-15-methyl-6-azapentacyclo[8.6.0.01,6.02,13.04,10]hexadecan-8-yl] benzoate |
| SMILES | C[C@@H]1C[C@@H]2C[C@@H](O)[C@@]34C[C@H](OC(=O)c5ccccc5)CN5C[C@@H]3C[C@@H]2[C@]54C1 |
| InChI | InChI=1S/C23H29NO3/c1-14-7-16-8-20(25)22-11-18(27-21(26)15-5-3-2-4-6-15)13-24-12-17(22)9-19(16)23(22,24)10-14/h2-6,14,16-20,25H,7-13H2,1H3/t14-,16-,17+,18+,19+,20-,22-,23+/m1/s1 |
| InChIKey | JDNADLAUPUHONX-KCHUPWOLSA-N |
| XLogP | 3.10 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |