C27H30N2O6 — CID 118727758
[(1R,5R,9S,11R,13R,14R,16S,17R,18S,19S)-16,19-dihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-13-yl] 4-nitrobenzoate (PubChem CID 118727758) has the molecular formula C27H30N2O6 and a molecular weight of 478.55 g/mol. Its IUPAC name is [(1R,5R,9S,11R,13R,14R,16S,17R,18S,19S)-16,19-dihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-13-yl] 4-nitrobenzoate.
| Compound Name | [(1R,5R,9S,11R,13R,14R,16S,17R,18S,19S)-16,19-dihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-13-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 118727758 |
| Molecular Formula | C27H30N2O6 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | [(1R,5R,9S,11R,13R,14R,16S,17R,18S,19S)-16,19-dihydroxy-5-methyl-12-methylidene-7-azaheptacyclo[9.6.2.01,8.05,17.07,16.09,14.014,18]nonadecan-13-yl] 4-nitrobenzoate |
| SMILES | C=C1[C@H]2C[C@@H]3C4N5C[C@]6(C)CCC[C@@]47[C@@H]6[C@@]5(O)C[C@]3([C@@H]1OC(=O)c1ccc([N+](=O)[O-])cc1)[C@H]7[C@H]2O |
| InChI | InChI=1S/C27H30N2O6/c1-13-16-10-17-20-25-9-3-8-24(2)12-28(20)27(32,23(24)25)11-26(17,19(25)18(16)30)21(13)35-22(31)14-4-6-15(7-5-14)29(33)34/h4-7,16-21,23,30,32H,1,3,8-12H2,2H3/t16-,17-,18+,19+,20?,21-,23-,24+,25+,26-,27+/m1/s1 |
| InChIKey | JRQWMJGTCKDSNA-SUEQITLSSA-N |
| XLogP | 2.89 |
| TPSA | 113.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|