C18H23NO3 — CID 163105271
5,16-dimethoxy-10-azatetracyclo[8.7.0.01,13.03,8]heptadeca-3,5,7,13-tetraen-6-ol (PubChem CID 163105271) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 5,16-dimethoxy-10-azatetracyclo[8.7.0.01,13.03,8]heptadeca-3,5,7,13-tetraen-6-ol.
| Compound Name | 5,16-dimethoxy-10-azatetracyclo[8.7.0.01,13.03,8]heptadeca-3,5,7,13-tetraen-6-ol |
|---|---|
| PubChem CID | 163105271 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 5,16-dimethoxy-10-azatetracyclo[8.7.0.01,13.03,8]heptadeca-3,5,7,13-tetraen-6-ol |
| SMILES | COc1cc2c(cc1O)CN1CCC3=CCC(OC)CC31C2 |
| InChI | InChI=1S/C18H23NO3/c1-21-15-4-3-14-5-6-19-11-13-7-16(20)17(22-2)8-12(13)9-18(14,19)10-15/h3,7-8,15,20H,4-6,9-11H2,1-2H3 |
| InChIKey | NSHUSMDHCCJJBM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|