C19H25NO3 — CID 162914620
4,17-dimethoxy-11-azatetracyclo[9.7.0.01,14.02,7]octadeca-2,4,6,14-tetraen-5-ol (PubChem CID 162914620) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 4,17-dimethoxy-11-azatetracyclo[9.7.0.01,14.02,7]octadeca-2,4,6,14-tetraen-5-ol.
| Compound Name | 4,17-dimethoxy-11-azatetracyclo[9.7.0.01,14.02,7]octadeca-2,4,6,14-tetraen-5-ol |
|---|---|
| PubChem CID | 162914620 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 4,17-dimethoxy-11-azatetracyclo[9.7.0.01,14.02,7]octadeca-2,4,6,14-tetraen-5-ol |
| SMILES | COc1cc2c(cc1O)CCCN1CCC3=CCC(OC)CC321 |
| InChI | InChI=1S/C19H25NO3/c1-22-15-6-5-14-7-9-20-8-3-4-13-10-17(21)18(23-2)11-16(13)19(14,20)12-15/h5,10-11,15,21H,3-4,6-9,12H2,1-2H3 |
| InChIKey | JQXBUOFFMQMBJB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|