C19H30O2 — CID 59818056
5,5-ditert-butyl-3-methoxy-7,8-dihydro-6H-naphthalen-2-ol (PubChem CID 59818056) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 5,5-ditert-butyl-3-methoxy-7,8-dihydro-6H-naphthalen-2-ol.
| Compound Name | 5,5-ditert-butyl-3-methoxy-7,8-dihydro-6H-naphthalen-2-ol |
|---|---|
| PubChem CID | 59818056 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 5,5-ditert-butyl-3-methoxy-7,8-dihydro-6H-naphthalen-2-ol |
| SMILES | COc1cc2c(cc1O)CCCC2(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C19H30O2/c1-17(2,3)19(18(4,5)6)10-8-9-13-11-15(20)16(21-7)12-14(13)19/h11-12,20H,8-10H2,1-7H3 |
| InChIKey | NGEBSNNURPTYFK-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |