C33H52O10 — CID 163106167
[3-(5-acetyloxy-3,4-dihydroxy-6-methyloxan-2-yl)oxy-5-(4,5-dihydroxy-3-methylidenepentyl)-1,1,4a,6-tetramethyl-2,3,4,5,8,8a-hexahydronaphthalen-2-yl] 2-methylbut-2-enoate (PubChem CID 163106167) has the molecular formula C33H52O10 and a molecular weight of 608.77 g/mol. Its IUPAC name is [3-(5-acetyloxy-3,4-dihydroxy-6-methyloxan-2-yl)oxy-5-(4,5-dihydroxy-3-methylidenepentyl)-1,1,4a,6-tetramethyl-2,3,4,5,8,8a-hexahydronaphthalen-2-yl] 2-methylbut-2-enoate.
| Compound Name | [3-(5-acetyloxy-3,4-dihydroxy-6-methyloxan-2-yl)oxy-5-(4,5-dihydroxy-3-methylidenepentyl)-1,1,4a,6-tetramethyl-2,3,4,5,8,8a-hexahydronaphthalen-2-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163106167 |
| Molecular Formula | C33H52O10 |
| Molecular Weight | 608.77 g/mol |
| Exact Mass | 608.36 |
| IUPAC Name | [3-(5-acetyloxy-3,4-dihydroxy-6-methyloxan-2-yl)oxy-5-(4,5-dihydroxy-3-methylidenepentyl)-1,1,4a,6-tetramethyl-2,3,4,5,8,8a-hexahydronaphthalen-2-yl] 2-methylbut-2-enoate |
| SMILES | C=C(CCC1C(C)=CCC2C(C)(C)C(OC(=O)C(C)=CC)C(OC3OC(C)C(OC(C)=O)C(O)C3O)CC12C)C(O)CO |
| InChI | InChI=1S/C33H52O10/c1-10-17(2)30(39)43-29-24(42-31-27(38)26(37)28(20(5)40-31)41-21(6)35)15-33(9)22(13-11-19(4)23(36)16-34)18(3)12-14-25(33)32(29,7)8/h10,12,20,22-29,31,34,36-38H,4,11,13-16H2,1-3,5-9H3 |
| InChIKey | UHUVXQZKXHSANE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.77 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|