C33H52O9 — CID 162897609
[5-(5-acetyloxy-3-methylpent-3-enyl)-1,1,4a,6-tetramethyl-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-2,3,4,5,8,8a-hexahydronaphthalen-2-yl] 2-methylbut-2-enoate (PubChem CID 162897609) has the molecular formula C33H52O9 and a molecular weight of 592.77 g/mol. Its IUPAC name is [5-(5-acetyloxy-3-methylpent-3-enyl)-1,1,4a,6-tetramethyl-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-2,3,4,5,8,8a-hexahydronaphthalen-2-yl] 2-methylbut-2-enoate.
| Compound Name | [5-(5-acetyloxy-3-methylpent-3-enyl)-1,1,4a,6-tetramethyl-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-2,3,4,5,8,8a-hexahydronaphthalen-2-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162897609 |
| Molecular Formula | C33H52O9 |
| Molecular Weight | 592.77 g/mol |
| Exact Mass | 592.36 |
| IUPAC Name | [5-(5-acetyloxy-3-methylpent-3-enyl)-1,1,4a,6-tetramethyl-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-2,3,4,5,8,8a-hexahydronaphthalen-2-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1C(OC2OC(C)C(O)C(O)C2O)CC2(C)C(CCC(C)=CCOC(C)=O)C(C)=CCC2C1(C)C |
| InChI | InChI=1S/C33H52O9/c1-10-19(3)30(38)42-29-24(41-31-28(37)27(36)26(35)21(5)40-31)17-33(9)23(13-11-18(2)15-16-39-22(6)34)20(4)12-14-25(33)32(29,7)8/h10,12,15,21,23-29,31,35-37H,11,13-14,16-17H2,1-9H3 |
| InChIKey | NECBARIBANEAGM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.77 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|