C38H40N4O2 — CID 163106715
10-(3-ethyl-6,7,12,12b-tetrahydroindolo[2,3-a]quinolizin-2-yl)-14-(2-hydroxyethylidene)-8,16-diazahexacyclo[11.5.2.11,8.02,7.016,19.012,21]henicosa-2,4,6,9-tetraen-11-ol (PubChem CID 163106715) has the molecular formula C38H40N4O2 and a molecular weight of 584.76 g/mol. Its IUPAC name is 10-(3-ethyl-6,7,12,12b-tetrahydroindolo[2,3-a]quinolizin-2-yl)-14-(2-hydroxyethylidene)-8,16-diazahexacyclo[11.5.2.11,8.02,7.016,19.012,21]henicosa-2,4,6,9-tetraen-11-ol.
| Compound Name | 10-(3-ethyl-6,7,12,12b-tetrahydroindolo[2,3-a]quinolizin-2-yl)-14-(2-hydroxyethylidene)-8,16-diazahexacyclo[11.5.2.11,8.02,7.016,19.012,21]henicosa-2,4,6,9-tetraen-11-ol |
|---|---|
| PubChem CID | 163106715 |
| Molecular Formula | C38H40N4O2 |
| Molecular Weight | 584.76 g/mol |
| Exact Mass | 584.32 |
| IUPAC Name | 10-(3-ethyl-6,7,12,12b-tetrahydroindolo[2,3-a]quinolizin-2-yl)-14-(2-hydroxyethylidene)-8,16-diazahexacyclo[11.5.2.11,8.02,7.016,19.012,21]henicosa-2,4,6,9-tetraen-11-ol |
| SMILES | CCC1=CN2CCc3c([nH]c4ccccc34)C2C=C1C1=CN2c3ccccc3C34CCN5CC(=CCO)C(CC53)C(C1O)C24 |
| InChI | InChI=1S/C38H40N4O2/c1-2-22-19-40-14-11-25-24-7-3-5-9-30(24)39-35(25)32(40)17-26(22)28-21-42-31-10-6-4-8-29(31)38-13-15-41-20-23(12-16-43)27(18-33(38)41)34(36(28)44)37(38)42/h3-10,12,17,19,21,27,32-34,36-37,39,43-44H,2,11,13-16,18,20H2,1H3 |
| InChIKey | YGZDQCVPTPXVQW-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.76 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|