C31H54O5 — CID 163108593
13-(hydroxymethyl)-17-[2-hydroxy-5-(2-methylcyclopropyl)hexan-2-yl]-3,3-dimethoxy-10-methyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-12-ol (PubChem CID 163108593) has the molecular formula C31H54O5 and a molecular weight of 506.77 g/mol. Its IUPAC name is 13-(hydroxymethyl)-17-[2-hydroxy-5-(2-methylcyclopropyl)hexan-2-yl]-3,3-dimethoxy-10-methyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-12-ol.
| Compound Name | 13-(hydroxymethyl)-17-[2-hydroxy-5-(2-methylcyclopropyl)hexan-2-yl]-3,3-dimethoxy-10-methyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-12-ol |
|---|---|
| PubChem CID | 163108593 |
| Molecular Formula | C31H54O5 |
| Molecular Weight | 506.77 g/mol |
| Exact Mass | 506.40 |
| IUPAC Name | 13-(hydroxymethyl)-17-[2-hydroxy-5-(2-methylcyclopropyl)hexan-2-yl]-3,3-dimethoxy-10-methyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-12-ol |
| SMILES | COC1(OC)CCC2(C)C(CCC3C2CC(O)C2(CO)C3CCC2C(C)(O)CCC(C)C2CC2C)C1 |
| InChI | InChI=1S/C31H54O5/c1-19(23-15-20(23)2)11-12-29(4,34)26-10-9-24-22-8-7-21-17-30(35-5,36-6)14-13-28(21,3)25(22)16-27(33)31(24,26)18-32/h19-27,32-34H,7-18H2,1-6H3 |
| InChIKey | FJPKSUYRIGJVGQ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.77 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|