C34H56O9 — CID 71593686
[3'-(1-acetyloxy-4-hydroxy-2,3,4-trimethylpentyl)-16-hydroxy-3,3-dimethoxy-10-methylspiro[2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxirane]-13-yl]methyl acetate (PubChem CID 71593686) has the molecular formula C34H56O9 and a molecular weight of 608.81 g/mol. Its IUPAC name is [3'-(1-acetyloxy-4-hydroxy-2,3,4-trimethylpentyl)-16-hydroxy-3,3-dimethoxy-10-methylspiro[2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxirane]-13-yl]methyl acetate.
| Compound Name | [3'-(1-acetyloxy-4-hydroxy-2,3,4-trimethylpentyl)-16-hydroxy-3,3-dimethoxy-10-methylspiro[2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxirane]-13-yl]methyl acetate |
|---|---|
| PubChem CID | 71593686 |
| Molecular Formula | C34H56O9 |
| Molecular Weight | 608.81 g/mol |
| Exact Mass | 608.39 |
| IUPAC Name | [3'-(1-acetyloxy-4-hydroxy-2,3,4-trimethylpentyl)-16-hydroxy-3,3-dimethoxy-10-methylspiro[2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxirane]-13-yl]methyl acetate |
| SMILES | COC1(OC)CCC2(C)C(CCC3C2CCC2(COC(C)=O)C3CC(O)C23OC3C(OC(C)=O)C(C)C(C)C(C)(C)O)C1 |
| InChI | InChI=1S/C34H56O9/c1-19(20(2)30(5,6)38)28(42-22(4)36)29-34(43-29)27(37)16-26-24-11-10-23-17-33(39-8,40-9)15-14-31(23,7)25(24)12-13-32(26,34)18-41-21(3)35/h19-20,23-29,37-38H,10-18H2,1-9H3 |
| InChIKey | YROBYHRRDLTUDO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 124.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.81 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|