C29H34O11 — CID 163108628
methyl (2R)-2-acetyloxy-2-[(1R,2S,5R,6R,13S,16S)-6-(2-hydroxy-5-oxo-2H-furan-4-yl)-1,5,15,15-tetramethyl-8,14,17-trioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-10-en-16-yl]acetate (PubChem CID 163108628) has the molecular formula C29H34O11 and a molecular weight of 558.58 g/mol. Its IUPAC name is methyl (2R)-2-acetyloxy-2-[(1R,2S,5R,6R,13S,16S)-6-(2-hydroxy-5-oxo-2H-furan-4-yl)-1,5,15,15-tetramethyl-8,14,17-trioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-10-en-16-yl]acetate.
| Compound Name | methyl (2R)-2-acetyloxy-2-[(1R,2S,5R,6R,13S,16S)-6-(2-hydroxy-5-oxo-2H-furan-4-yl)-1,5,15,15-tetramethyl-8,14,17-trioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-10-en-16-yl]acetate |
|---|---|
| PubChem CID | 163108628 |
| Molecular Formula | C29H34O11 |
| Molecular Weight | 558.58 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | methyl (2R)-2-acetyloxy-2-[(1R,2S,5R,6R,13S,16S)-6-(2-hydroxy-5-oxo-2H-furan-4-yl)-1,5,15,15-tetramethyl-8,14,17-trioxo-7-oxatetracyclo[11.3.1.02,11.05,10]heptadec-10-en-16-yl]acetate |
| SMILES | COC(=O)[C@H](OC(C)=O)[C@H]1C(C)(C)C(=O)[C@@H]2CC3=C4CC(=O)O[C@@H](C5=CC(O)OC5=O)[C@]4(C)CC[C@@H]3[C@@]1(C)C2=O |
| InChI | InChI=1S/C29H34O11/c1-12(30)38-20(26(36)37-6)21-27(2,3)22(33)14-9-13-16(29(21,5)23(14)34)7-8-28(4)17(13)11-19(32)39-24(28)15-10-18(31)40-25(15)35/h10,14,16,18,20-21,24,31H,7-9,11H2,1-6H3/t14-,16-,18?,20+,21-,24-,28+,29+/m0/s1 |
| InChIKey | FLRSOKDKASIUSC-VBCFXEPQSA-N |
| XLogP | 1.74 |
| TPSA | 159.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.58 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|