C12H20ClNO — CID 163108896
4-chloro-2-hepta-3,5-dienylpiperidin-3-ol (PubChem CID 163108896) has the molecular formula C12H20ClNO and a molecular weight of 229.75 g/mol. Its IUPAC name is 4-chloro-2-hepta-3,5-dienylpiperidin-3-ol.
| Compound Name | 4-chloro-2-hepta-3,5-dienylpiperidin-3-ol |
|---|---|
| PubChem CID | 163108896 |
| Molecular Formula | C12H20ClNO |
| Molecular Weight | 229.75 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 4-chloro-2-hepta-3,5-dienylpiperidin-3-ol |
| SMILES | CC=CC=CCCC1NCCC(Cl)C1O |
| InChI | InChI=1S/C12H20ClNO/c1-2-3-4-5-6-7-11-12(15)10(13)8-9-14-11/h2-5,10-12,14-15H,6-9H2,1H3 |
| InChIKey | GEGGODVKMZQIOL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.75 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|