C22H30O6 — CID 163109278
[(1S,9R,13R,18R,19R)-9-formyl-5,5-dimethyl-14-oxo-15,17-dioxapentacyclo[11.5.1.01,10.04,9.016,19]nonadecan-18-yl] acetate (PubChem CID 163109278) has the molecular formula C22H30O6 and a molecular weight of 390.48 g/mol. Its IUPAC name is [(1S,9R,13R,18R,19R)-9-formyl-5,5-dimethyl-14-oxo-15,17-dioxapentacyclo[11.5.1.01,10.04,9.016,19]nonadecan-18-yl] acetate.
| Compound Name | [(1S,9R,13R,18R,19R)-9-formyl-5,5-dimethyl-14-oxo-15,17-dioxapentacyclo[11.5.1.01,10.04,9.016,19]nonadecan-18-yl] acetate |
|---|---|
| PubChem CID | 163109278 |
| Molecular Formula | C22H30O6 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | [(1S,9R,13R,18R,19R)-9-formyl-5,5-dimethyl-14-oxo-15,17-dioxapentacyclo[11.5.1.01,10.04,9.016,19]nonadecan-18-yl] acetate |
| SMILES | CC(=O)O[C@H]1OC2OC(=O)[C@@H]3CCC4[C@@]5(C=O)CCCC(C)(C)C5CC[C@@]41[C@H]23 |
| InChI | InChI=1S/C22H30O6/c1-12(24)26-19-22-10-7-14-20(2,3)8-4-9-21(14,11-23)15(22)6-5-13-16(22)18(28-19)27-17(13)25/h11,13-16,18-19H,4-10H2,1-3H3/t13-,14?,15?,16+,18?,19+,21-,22+/m1/s1 |
| InChIKey | HFBVZFJBCJCDQZ-BUBWBHLHSA-N |
| XLogP | 3.22 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|