C24H35NO5S — CID 163109679
2-[[5-[[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]-methylamino]ethanesulfonic acid (PubChem CID 163109679) has the molecular formula C24H35NO5S and a molecular weight of 449.61 g/mol. Its IUPAC name is 2-[[5-[[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]-methylamino]ethanesulfonic acid.
| Compound Name | 2-[[5-[[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]-methylamino]ethanesulfonic acid |
|---|---|
| PubChem CID | 163109679 |
| Molecular Formula | C24H35NO5S |
| Molecular Weight | 449.61 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 2-[[5-[[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]-methylamino]ethanesulfonic acid |
| SMILES | CC1=CCC[C@@H]2[C@@](C)(CC3=CC(=O)C=C(N(C)CCS(=O)(=O)O)C3=O)[C@H](C)CC[C@@]12C |
| InChI | InChI=1S/C24H35NO5S/c1-16-7-6-8-21-23(16,3)10-9-17(2)24(21,4)15-18-13-19(26)14-20(22(18)27)25(5)11-12-31(28,29)30/h7,13-14,17,21H,6,8-12,15H2,1-5H3,(H,28,29,30)/t17-,21+,23+,24+/m1/s1 |
| InChIKey | IIBMCVXJGCEMEG-WEKBHZFBSA-N |
| XLogP | 3.96 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.61 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|