C24H33NO7S — CID 177396289
(2S)-2-[[4-[[(1R,2S,4aS,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]-3-sulfopropanoic acid (PubChem CID 177396289) has the molecular formula C24H33NO7S and a molecular weight of 479.60 g/mol. Its IUPAC name is (2S)-2-[[4-[[(1R,2S,4aS,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]-3-sulfopropanoic acid.
| Compound Name | (2S)-2-[[4-[[(1R,2S,4aS,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]-3-sulfopropanoic acid |
|---|---|
| PubChem CID | 177396289 |
| Molecular Formula | C24H33NO7S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | (2S)-2-[[4-[[(1R,2S,4aS,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]-3-sulfopropanoic acid |
| SMILES | CC1=CCC[C@H]2[C@](C)(CC3=CC(=O)C(N[C@H](CS(=O)(=O)O)C(=O)O)=CC3=O)[C@@H](C)CC[C@]12C |
| InChI | InChI=1S/C24H33NO7S/c1-14-6-5-7-21-23(14,3)9-8-15(2)24(21,4)12-16-10-20(27)17(11-19(16)26)25-18(22(28)29)13-33(30,31)32/h6,10-11,15,18,21,25H,5,7-9,12-13H2,1-4H3,(H,28,29)(H,30,31,32)/t15-,18+,21+,23+,24+/m0/s1 |
| InChIKey | RQHRGEBYTVQSIE-BAISACOHSA-N |
| XLogP | 3.07 |
| TPSA | 137.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|