C15H20O4 — CID 163109790
6,7b-dimethyl-2,2a,4a,5,7,7a-hexahydro-1H-cyclobuta[e]indene-3,6-dicarboxylic acid (PubChem CID 163109790) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 6,7b-dimethyl-2,2a,4a,5,7,7a-hexahydro-1H-cyclobuta[e]indene-3,6-dicarboxylic acid.
| Compound Name | 6,7b-dimethyl-2,2a,4a,5,7,7a-hexahydro-1H-cyclobuta[e]indene-3,6-dicarboxylic acid |
|---|---|
| PubChem CID | 163109790 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 6,7b-dimethyl-2,2a,4a,5,7,7a-hexahydro-1H-cyclobuta[e]indene-3,6-dicarboxylic acid |
| SMILES | CC1(C(=O)O)CC2C=C(C(=O)O)C3CCC3(C)C2C1 |
| InChI | InChI=1S/C15H20O4/c1-14(13(18)19)6-8-5-9(12(16)17)10-3-4-15(10,2)11(8)7-14/h5,8,10-11H,3-4,6-7H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | IPGWJKFNMYXJRY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |