About 1-methyl-8-propan-2-yltricyclo[4.4.0.02,7]dec-3-ene-3-carboxylic acid
1-methyl-8-propan-2-yltricyclo[4.4.0.02,7]dec-3-ene-3-carboxylic acid (PubChem CID 148847183) has the molecular formula C15H22O2
and a molecular weight of 234.34 g/mol. Its IUPAC name is 1-methyl-8-propan-2-yltricyclo[4.4.0.02,7]dec-3-ene-3-carboxylic acid.
Analyze 1-methyl-8-propan-2-yltricyclo[4.4.0.02,7]dec-3-ene-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-8-propan-2-yltricyclo[4.4.0.02,7]dec-3-ene-3-carboxylic acid?
The IUPAC name of 1-methyl-8-propan-2-yltricyclo[4.4.0.02,7]dec-3-ene-3-carboxylic acid (CID 148847183) is 1-methyl-8-propan-2-yltricyclo[4.4.0.02,7]dec-3-ene-3-carboxylic acid.
What is the SMILES notation for 1-methyl-8-propan-2-yltricyclo[4.4.0.02,7]dec-3-ene-3-carboxylic acid?
The canonical SMILES for 1-methyl-8-propan-2-yltricyclo[4.4.0.02,7]dec-3-ene-3-carboxylic acid is CC(C)C1CCC2(C)C3CC=C(C(=O)O)C2C13.
What is the InChIKey of 1-methyl-8-propan-2-yltricyclo[4.4.0.02,7]dec-3-ene-3-carboxylic acid?
The InChIKey is OWRXXWMFSVYUSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O2/c1-8(2)9-6-7-15(3)11-5-4-10(14(16)17)13(15)12(9)11/h4,8-9,11-13H,5-7H2,1-3H3,(H,16,17).
What are the key properties of 1-methyl-8-propan-2-yltricyclo[4.4.0.02,7]dec-3-ene-3-carboxylic acid?
1-methyl-8-propan-2-yltricyclo[4.4.0.02,7]dec-3-ene-3-carboxylic acid has a molecular weight of 234.34 g/mol, XLogP of 3.34, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-8-propan-2-yltricyclo[4.4.0.02,7]dec-3-ene-3-carboxylic acid is sourced from PubChem (CID 148847183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).