2-(1-methyl-8-propan-2-yl-3-tricyclo[4.4.0.02,7]decanyl)propanoic acid

C17H28O2 — CID 129018732

IUPAC2-(1-methyl-8-propan-2-yl-3-tricyclo[4.4.0.02,7]decanyl)propanoic acid
SMILESCC(C)C1CCC2(C)C3CCC(C(C)C(=O)O)C2C13
InChIInChI=1S/C17H28O2/c1-9(2)11-7-8-17(4)13-6-5-12(10(3)16(18)19)15(17)14(11)13/h9-15H,5-8H2,1-4H3,(H,18,19)
InChIKeyFYVXZSOKXIOBOT-UHFFFAOYSA-N
MW264.41 g/mol
LogP4.05
Rot. Bonds3

About 2-(1-methyl-8-propan-2-yl-3-tricyclo[4.4.0.02,7]decanyl)propanoic acid

2-(1-methyl-8-propan-2-yl-3-tricyclo[4.4.0.02,7]decanyl)propanoic acid (PubChem CID 129018732) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 2-(1-methyl-8-propan-2-yl-3-tricyclo[4.4.0.02,7]decanyl)propanoic acid.

Molecular Properties

Compound Name2-(1-methyl-8-propan-2-yl-3-tricyclo[4.4.0.02,7]decanyl)propanoic acid
PubChem CID129018732
Molecular FormulaC17H28O2
Molecular Weight264.41 g/mol
Exact Mass264.21
IUPAC Name2-(1-methyl-8-propan-2-yl-3-tricyclo[4.4.0.02,7]decanyl)propanoic acid
SMILESCC(C)C1CCC2(C)C3CCC(C(C)C(=O)O)C2C13
InChIInChI=1S/C17H28O2/c1-9(2)11-7-8-17(4)13-6-5-12(10(3)16(18)19)15(17)14(11)13/h9-15H,5-8H2,1-4H3,(H,18,19)
InChIKeyFYVXZSOKXIOBOT-UHFFFAOYSA-N
XLogP4.05
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.41
LogP ≤ 54.05
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-(1-methyl-8-propan-2-yl-3-tricyclo[4.4.0.02,7]decanyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1-methyl-8-propan-2-yl-3-tricyclo[4.4.0.02,7]decanyl)propanoic acid?
The IUPAC name of 2-(1-methyl-8-propan-2-yl-3-tricyclo[4.4.0.02,7]decanyl)propanoic acid (CID 129018732) is 2-(1-methyl-8-propan-2-yl-3-tricyclo[4.4.0.02,7]decanyl)propanoic acid.
What is the SMILES notation for 2-(1-methyl-8-propan-2-yl-3-tricyclo[4.4.0.02,7]decanyl)propanoic acid?
The canonical SMILES for 2-(1-methyl-8-propan-2-yl-3-tricyclo[4.4.0.02,7]decanyl)propanoic acid is CC(C)C1CCC2(C)C3CCC(C(C)C(=O)O)C2C13.
What is the InChIKey of 2-(1-methyl-8-propan-2-yl-3-tricyclo[4.4.0.02,7]decanyl)propanoic acid?
The InChIKey is FYVXZSOKXIOBOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O2/c1-9(2)11-7-8-17(4)13-6-5-12(10(3)16(18)19)15(17)14(11)13/h9-15H,5-8H2,1-4H3,(H,18,19).
What are the key properties of 2-(1-methyl-8-propan-2-yl-3-tricyclo[4.4.0.02,7]decanyl)propanoic acid?
2-(1-methyl-8-propan-2-yl-3-tricyclo[4.4.0.02,7]decanyl)propanoic acid has a molecular weight of 264.41 g/mol, XLogP of 4.05, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methyl-8-propan-2-yl-3-tricyclo[4.4.0.02,7]decanyl)propanoic acid is sourced from PubChem (CID 129018732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).