C8H12O3 — CID 57371256
(2S)-2-[(1R,5S)-6-oxabicyclo[3.1.0]hexan-2-yl]propanoic acid (PubChem CID 57371256) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is (2S)-2-[(1R,5S)-6-oxabicyclo[3.1.0]hexan-2-yl]propanoic acid.
| Compound Name | (2S)-2-[(1R,5S)-6-oxabicyclo[3.1.0]hexan-2-yl]propanoic acid |
|---|---|
| PubChem CID | 57371256 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | (2S)-2-[(1R,5S)-6-oxabicyclo[3.1.0]hexan-2-yl]propanoic acid |
| SMILES | C[C@H](C(=O)O)C1CC[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C8H12O3/c1-4(8(9)10)5-2-3-6-7(5)11-6/h4-7H,2-3H2,1H3,(H,9,10)/t4-,5?,6-,7+/m0/s1 |
| InChIKey | DVRGUALRCRHKJY-HNMQFRHFSA-N |
| XLogP | 0.88 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|