C7H9FO2 — CID 88891169
2-fluoro-2-[(1R,2S,5S)-6-oxabicyclo[3.1.0]hexan-2-yl]acetaldehyde (PubChem CID 88891169) has the molecular formula C7H9FO2 and a molecular weight of 144.15 g/mol. Its IUPAC name is 2-fluoro-2-[(1R,2S,5S)-6-oxabicyclo[3.1.0]hexan-2-yl]acetaldehyde.
| Compound Name | 2-fluoro-2-[(1R,2S,5S)-6-oxabicyclo[3.1.0]hexan-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 88891169 |
| Molecular Formula | C7H9FO2 |
| Molecular Weight | 144.15 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | 2-fluoro-2-[(1R,2S,5S)-6-oxabicyclo[3.1.0]hexan-2-yl]acetaldehyde |
| SMILES | O=CC(F)[C@H]1CC[C@@H]2O[C@@H]21 |
| InChI | InChI=1S/C7H9FO2/c8-5(3-9)4-1-2-6-7(4)10-6/h3-7H,1-2H2/t4-,5?,6+,7-/m1/s1 |
| InChIKey | XVZRBIQSIOQHIR-ZFGFBIEISA-N |
| XLogP | 0.70 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.15 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|