C18H31NO — CID 163111119
4-methyl-6-octa-1,3-dienyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-ol (PubChem CID 163111119) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is 4-methyl-6-octa-1,3-dienyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-ol.
| Compound Name | 4-methyl-6-octa-1,3-dienyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-ol |
|---|---|
| PubChem CID | 163111119 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | 4-methyl-6-octa-1,3-dienyl-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-3-ol |
| SMILES | CCCCC=CC=CC1CCCC2CCC(O)C(C)N12 |
| InChI | InChI=1S/C18H31NO/c1-3-4-5-6-7-8-10-16-11-9-12-17-13-14-18(20)15(2)19(16)17/h6-8,10,15-18,20H,3-5,9,11-14H2,1-2H3 |
| InChIKey | MGSVZAIVEUDBBE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|