C30H52O6 — CID 163112450
6-[2-(7-hydroperoxy-1-hydroxy-1,4,4-trimethyl-6-methylidene-3,3a,5,7,8,8a-hexahydro-2H-azulen-5-yl)ethyl]-2,2,5a,7-tetramethyl-4,5,6,8,9,9a-hexahydro-3H-benzo[b]oxepine-3,7-diol (PubChem CID 163112450) has the molecular formula C30H52O6 and a molecular weight of 508.74 g/mol. Its IUPAC name is 6-[2-(7-hydroperoxy-1-hydroxy-1,4,4-trimethyl-6-methylidene-3,3a,5,7,8,8a-hexahydro-2H-azulen-5-yl)ethyl]-2,2,5a,7-tetramethyl-4,5,6,8,9,9a-hexahydro-3H-benzo[b]oxepine-3,7-diol.
| Compound Name | 6-[2-(7-hydroperoxy-1-hydroxy-1,4,4-trimethyl-6-methylidene-3,3a,5,7,8,8a-hexahydro-2H-azulen-5-yl)ethyl]-2,2,5a,7-tetramethyl-4,5,6,8,9,9a-hexahydro-3H-benzo[b]oxepine-3,7-diol |
|---|---|
| PubChem CID | 163112450 |
| Molecular Formula | C30H52O6 |
| Molecular Weight | 508.74 g/mol |
| Exact Mass | 508.38 |
| IUPAC Name | 6-[2-(7-hydroperoxy-1-hydroxy-1,4,4-trimethyl-6-methylidene-3,3a,5,7,8,8a-hexahydro-2H-azulen-5-yl)ethyl]-2,2,5a,7-tetramethyl-4,5,6,8,9,9a-hexahydro-3H-benzo[b]oxepine-3,7-diol |
| SMILES | C=C1C(OO)CC2C(CCC2(C)O)C(C)(C)C1CCC1C(C)(O)CCC2OC(C)(C)C(O)CCC21C |
| InChI | InChI=1S/C30H52O6/c1-18-19(26(2,3)20-11-15-29(7,32)21(20)17-22(18)36-34)9-10-23-28(6)14-12-24(31)27(4,5)35-25(28)13-16-30(23,8)33/h19-25,31-34H,1,9-17H2,2-8H3 |
| InChIKey | PWINAHBZPRMJKO-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.74 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|