C60H100O8 — CID 139114314
(2R,5R,8R,11R,12S,17R,20R,23R)-2,7,7,11,17,21,21-heptamethyl-6,22-dioxapentacyclo[13.10.0.02,12.05,11.017,23]pentacos-1(15)-ene-8,20-diol (PubChem CID 139114314) has the molecular formula C60H100O8 and a molecular weight of 949.45 g/mol. Its IUPAC name is (2R,5R,8R,11R,12S,17R,20R,23R)-2,7,7,11,17,21,21-heptamethyl-6,22-dioxapentacyclo[13.10.0.02,12.05,11.017,23]pentacos-1(15)-ene-8,20-diol.
| Compound Name | (2R,5R,8R,11R,12S,17R,20R,23R)-2,7,7,11,17,21,21-heptamethyl-6,22-dioxapentacyclo[13.10.0.02,12.05,11.017,23]pentacos-1(15)-ene-8,20-diol |
|---|---|
| PubChem CID | 139114314 |
| Molecular Formula | C60H100O8 |
| Molecular Weight | 949.45 g/mol |
| Exact Mass | 948.74 |
| IUPAC Name | (2R,5R,8R,11R,12S,17R,20R,23R)-2,7,7,11,17,21,21-heptamethyl-6,22-dioxapentacyclo[13.10.0.02,12.05,11.017,23]pentacos-1(15)-ene-8,20-diol |
| SMILES | CC1(C)O[C@@H]2CCC3=C(CC[C@@H]4[C@@]5(C)CC[C@@H](O)C(C)(C)O[C@@H]5CC[C@@]34C)C[C@@]2(C)CC[C@H]1O.CC1(C)O[C@@H]2CCC3=C(CC[C@@H]4[C@@]5(C)CC[C@@H](O)C(C)(C)O[C@@H]5CC[C@@]34C)C[C@@]2(C)CC[C@H]1O |
| InChI | InChI=1S/2C30H50O4/c2*1-26(2)22(31)12-15-28(5)18-19-8-10-21-29(6,20(19)9-11-24(28)33-26)17-14-25-30(21,7)16-13-23(32)27(3,4)34-25/h2*21-25,31-32H,8-18H2,1-7H3/t2*21-,22+,23+,24+,25+,28+,29-,30+/m00/s1 |
| InChIKey | PPMHWEMRCCMRPJ-QNFAEWABSA-N |
| XLogP | 12.65 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.45 |
| LogP ≤ 5 | 12.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|