C20H30 — CID 163113446
8-ethenyl-2,4,8-trimethyl-4-(4-methylpenta-1,3-dienyl)bicyclo[3.3.1]non-2-ene (PubChem CID 163113446) has the molecular formula C20H30 and a molecular weight of 270.46 g/mol. Its IUPAC name is 8-ethenyl-2,4,8-trimethyl-4-(4-methylpenta-1,3-dienyl)bicyclo[3.3.1]non-2-ene.
| Compound Name | 8-ethenyl-2,4,8-trimethyl-4-(4-methylpenta-1,3-dienyl)bicyclo[3.3.1]non-2-ene |
|---|---|
| PubChem CID | 163113446 |
| Molecular Formula | C20H30 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 8-ethenyl-2,4,8-trimethyl-4-(4-methylpenta-1,3-dienyl)bicyclo[3.3.1]non-2-ene |
| SMILES | C=CC1(C)CCC2CC1C(C)=CC2(C)C=CC=C(C)C |
| InChI | InChI=1S/C20H30/c1-7-19(5)12-10-17-13-18(19)16(4)14-20(17,6)11-8-9-15(2)3/h7-9,11,14,17-18H,1,10,12-13H2,2-6H3 |
| InChIKey | SFKYZSKWSOFPBT-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|