C18H23ClN4O4S — CID 163118336
(3aR,4S,6R,7R,7aS)-N-(2-acetamidoethyl)-3-(4-chlorophenyl)-6,7-dihydroxy-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide (PubChem CID 163118336) has the molecular formula C18H23ClN4O4S and a molecular weight of 426.93 g/mol. Its IUPAC name is (3aR,4S,6R,7R,7aS)-N-(2-acetamidoethyl)-3-(4-chlorophenyl)-6,7-dihydroxy-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide.
| Compound Name | (3aR,4S,6R,7R,7aS)-N-(2-acetamidoethyl)-3-(4-chlorophenyl)-6,7-dihydroxy-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 163118336 |
| Molecular Formula | C18H23ClN4O4S |
| Molecular Weight | 426.93 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | (3aR,4S,6R,7R,7aS)-N-(2-acetamidoethyl)-3-(4-chlorophenyl)-6,7-dihydroxy-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
| SMILES | CC(=O)NCCNC(=O)[C@H]1C[C@@H](O)[C@H](O)[C@H]2NC(=S)N(c3ccc(Cl)cc3)[C@@H]21 |
| InChI | InChI=1S/C18H23ClN4O4S/c1-9(24)20-6-7-21-17(27)12-8-13(25)16(26)14-15(12)23(18(28)22-14)11-4-2-10(19)3-5-11/h2-5,12-16,25-26H,6-8H2,1H3,(H,20,24)(H,21,27)(H,22,28)/t12-,13+,14-,15+,16-/m0/s1 |
| InChIKey | AQFCNERTLCFDCD-NPJQDHAYSA-N |
| XLogP | -0.23 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.93 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|