C18H27N4O3S+ — CID 11940040
2-[[(3aR,4R,6R,7R,7aR)-6,7-dihydroxy-3-phenyl-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carbonyl]amino]ethyl-dimethylazanium (PubChem CID 11940040) has the molecular formula C18H27N4O3S+ and a molecular weight of 379.51 g/mol. Its IUPAC name is 2-[[(3aR,4R,6R,7R,7aR)-6,7-dihydroxy-3-phenyl-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carbonyl]amino]ethyl-dimethylazanium.
| Compound Name | 2-[[(3aR,4R,6R,7R,7aR)-6,7-dihydroxy-3-phenyl-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carbonyl]amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 11940040 |
| Molecular Formula | C18H27N4O3S+ |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 2-[[(3aR,4R,6R,7R,7aR)-6,7-dihydroxy-3-phenyl-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carbonyl]amino]ethyl-dimethylazanium |
| SMILES | C[NH+](C)CCNC(=O)[C@@H]1C[C@@H](O)[C@H](O)[C@@H]2NC(=S)N(c3ccccc3)[C@@H]21 |
| InChI | InChI=1S/C18H26N4O3S/c1-21(2)9-8-19-17(25)12-10-13(23)16(24)14-15(12)22(18(26)20-14)11-6-4-3-5-7-11/h3-7,12-16,23-24H,8-10H2,1-2H3,(H,19,25)(H,20,26)/p+1/t12-,13-,14-,15-,16+/m1/s1 |
| InChIKey | QLADEMQGFLKEEB-QCODTGAPSA-O |
| XLogP | -1.88 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|