C22H22F3N3O3S — CID 163169629
(3aR,4S,6R,7R,7aS)-N-benzyl-6,7-dihydroxy-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide (PubChem CID 163169629) has the molecular formula C22H22F3N3O3S and a molecular weight of 465.50 g/mol. Its IUPAC name is (3aR,4S,6R,7R,7aS)-N-benzyl-6,7-dihydroxy-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide.
| Compound Name | (3aR,4S,6R,7R,7aS)-N-benzyl-6,7-dihydroxy-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 163169629 |
| Molecular Formula | C22H22F3N3O3S |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | (3aR,4S,6R,7R,7aS)-N-benzyl-6,7-dihydroxy-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)[C@H]1C[C@@H](O)[C@H](O)[C@H]2NC(=S)N(c3cccc(C(F)(F)F)c3)[C@@H]21 |
| InChI | InChI=1S/C22H22F3N3O3S/c23-22(24,25)13-7-4-8-14(9-13)28-18-15(10-16(29)19(30)17(18)27-21(28)32)20(31)26-11-12-5-2-1-3-6-12/h1-9,15-19,29-30H,10-11H2,(H,26,31)(H,27,32)/t15-,16+,17-,18+,19-/m0/s1 |
| InChIKey | UVJIWMSBBCXLSV-APAFKAMOSA-N |
| XLogP | 2.20 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|