C21H21N5O3S — CID 74736889
3-(3-cyanophenyl)-6,7-dihydroxy-N-(pyridin-3-ylmethyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide (PubChem CID 74736889) has the molecular formula C21H21N5O3S and a molecular weight of 423.50 g/mol. Its IUPAC name is 3-(3-cyanophenyl)-6,7-dihydroxy-N-(pyridin-3-ylmethyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide.
| Compound Name | 3-(3-cyanophenyl)-6,7-dihydroxy-N-(pyridin-3-ylmethyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 74736889 |
| Molecular Formula | C21H21N5O3S |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 3-(3-cyanophenyl)-6,7-dihydroxy-N-(pyridin-3-ylmethyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
| SMILES | N#Cc1cccc(N2C(=S)NC3C(O)C(O)CC(C(=O)NCc4cccnc4)C32)c1 |
| InChI | InChI=1S/C21H21N5O3S/c22-9-12-3-1-5-14(7-12)26-18-15(8-16(27)19(28)17(18)25-21(26)30)20(29)24-11-13-4-2-6-23-10-13/h1-7,10,15-19,27-28H,8,11H2,(H,24,29)(H,25,30) |
| InChIKey | NRTYJEGVIWFELY-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 121.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|