C20H24F3N3O3S — CID 40780735
(3aR,4R,6R,7R,7aR)-N-cyclopentyl-6,7-dihydroxy-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide (PubChem CID 40780735) has the molecular formula C20H24F3N3O3S and a molecular weight of 443.49 g/mol. Its IUPAC name is (3aR,4R,6R,7R,7aR)-N-cyclopentyl-6,7-dihydroxy-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide.
| Compound Name | (3aR,4R,6R,7R,7aR)-N-cyclopentyl-6,7-dihydroxy-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 40780735 |
| Molecular Formula | C20H24F3N3O3S |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | (3aR,4R,6R,7R,7aR)-N-cyclopentyl-6,7-dihydroxy-2-sulfanylidene-3-[3-(trifluoromethyl)phenyl]-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
| SMILES | O=C(NC1CCCC1)[C@@H]1C[C@@H](O)[C@H](O)[C@@H]2NC(=S)N(c3cccc(C(F)(F)F)c3)[C@@H]21 |
| InChI | InChI=1S/C20H24F3N3O3S/c21-20(22,23)10-4-3-7-12(8-10)26-16-13(18(29)24-11-5-1-2-6-11)9-14(27)17(28)15(16)25-19(26)30/h3-4,7-8,11,13-17,27-28H,1-2,5-6,9H2,(H,24,29)(H,25,30)/t13-,14-,15-,16-,17+/m1/s1 |
| InChIKey | FMOYCBXWWUGORP-HHARLNAUSA-N |
| XLogP | 1.94 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|