C21H23ClN4O3S — CID 74736886
3-(3-chloro-4-methylphenyl)-6,7-dihydroxy-N-(pyridin-3-ylmethyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide (PubChem CID 74736886) has the molecular formula C21H23ClN4O3S and a molecular weight of 446.96 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-6,7-dihydroxy-N-(pyridin-3-ylmethyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide.
| Compound Name | 3-(3-chloro-4-methylphenyl)-6,7-dihydroxy-N-(pyridin-3-ylmethyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 74736886 |
| Molecular Formula | C21H23ClN4O3S |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-6,7-dihydroxy-N-(pyridin-3-ylmethyl)-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
| SMILES | Cc1ccc(N2C(=S)NC3C(O)C(O)CC(C(=O)NCc4cccnc4)C32)cc1Cl |
| InChI | InChI=1S/C21H23ClN4O3S/c1-11-4-5-13(7-15(11)22)26-18-14(8-16(27)19(28)17(18)25-21(26)30)20(29)24-10-12-3-2-6-23-9-12/h2-7,9,14,16-19,27-28H,8,10H2,1H3,(H,24,29)(H,25,30) |
| InChIKey | WWQWHFAZUPJTQS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|