C19H26N4O5S — CID 163121589
N-(2-acetamidoethyl)-4,5-dihydroxy-2-(4-methoxyanilino)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide (PubChem CID 163121589) has the molecular formula C19H26N4O5S and a molecular weight of 422.51 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-4,5-dihydroxy-2-(4-methoxyanilino)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-4,5-dihydroxy-2-(4-methoxyanilino)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
|---|---|
| PubChem CID | 163121589 |
| Molecular Formula | C19H26N4O5S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | N-(2-acetamidoethyl)-4,5-dihydroxy-2-(4-methoxyanilino)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carboxamide |
| SMILES | COc1ccc(NC2=NC3C(O)C(O)CC(C(=O)NCCNC(C)=O)C3S2)cc1 |
| InChI | InChI=1S/C19H26N4O5S/c1-10(24)20-7-8-21-18(27)13-9-14(25)16(26)15-17(13)29-19(23-15)22-11-3-5-12(28-2)6-4-11/h3-6,13-17,25-26H,7-9H2,1-2H3,(H,20,24)(H,21,27)(H,22,23) |
| InChIKey | BSERYSZJCRIAPJ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 132.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|