C22H30N4O6S — CID 74736961
1-[2-(3,5-dimethoxyanilino)-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carbonyl]piperidine-4-carboxamide (PubChem CID 74736961) has the molecular formula C22H30N4O6S and a molecular weight of 478.57 g/mol. Its IUPAC name is 1-[2-(3,5-dimethoxyanilino)-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carbonyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-(3,5-dimethoxyanilino)-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 74736961 |
| Molecular Formula | C22H30N4O6S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 1-[2-(3,5-dimethoxyanilino)-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carbonyl]piperidine-4-carboxamide |
| SMILES | COc1cc(NC2=NC3C(O)C(O)CC(C(=O)N4CCC(C(N)=O)CC4)C3S2)cc(OC)c1 |
| InChI | InChI=1S/C22H30N4O6S/c1-31-13-7-12(8-14(9-13)32-2)24-22-25-17-18(28)16(27)10-15(19(17)33-22)21(30)26-5-3-11(4-6-26)20(23)29/h7-9,11,15-19,27-28H,3-6,10H2,1-2H3,(H2,23,29)(H,24,25) |
| InChIKey | WPKMCJILRAJOHB-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 146.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |