C19H24FN3O3S — CID 73149647
[2-(4-fluoroanilino)-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-7-yl]-piperidin-1-ylmethanone (PubChem CID 73149647) has the molecular formula C19H24FN3O3S and a molecular weight of 393.48 g/mol. Its IUPAC name is [2-(4-fluoroanilino)-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-7-yl]-piperidin-1-ylmethanone.
| Compound Name | [2-(4-fluoroanilino)-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-7-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 73149647 |
| Molecular Formula | C19H24FN3O3S |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | [2-(4-fluoroanilino)-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-7-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(C1CC(O)C(O)C2N=C(Nc3ccc(F)cc3)SC12)N1CCCCC1 |
| InChI | InChI=1S/C19H24FN3O3S/c20-11-4-6-12(7-5-11)21-19-22-15-16(25)14(24)10-13(17(15)27-19)18(26)23-8-2-1-3-9-23/h4-7,13-17,24-25H,1-3,8-10H2,(H,21,22) |
| InChIKey | UWOYEXUTLKMTHF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |