C20H27N3O3S — CID 74736932
[4,5-dihydroxy-2-(4-methylanilino)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-7-yl]-piperidin-1-ylmethanone (PubChem CID 74736932) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is [4,5-dihydroxy-2-(4-methylanilino)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-7-yl]-piperidin-1-ylmethanone.
| Compound Name | [4,5-dihydroxy-2-(4-methylanilino)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-7-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 74736932 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | [4,5-dihydroxy-2-(4-methylanilino)-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazol-7-yl]-piperidin-1-ylmethanone |
| SMILES | Cc1ccc(NC2=NC3C(O)C(O)CC(C(=O)N4CCCCC4)C3S2)cc1 |
| InChI | InChI=1S/C20H27N3O3S/c1-12-5-7-13(8-6-12)21-20-22-16-17(25)15(24)11-14(18(16)27-20)19(26)23-9-3-2-4-10-23/h5-8,14-18,24-25H,2-4,9-11H2,1H3,(H,21,22) |
| InChIKey | DDVTYBUYZGMZPS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |