C20H25ClN4O4S — CID 163176713
1-[(3aR,4R,5R,7R,7aR)-2-(4-chloroanilino)-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carbonyl]piperidine-4-carboxamide (PubChem CID 163176713) has the molecular formula C20H25ClN4O4S and a molecular weight of 452.96 g/mol. Its IUPAC name is 1-[(3aR,4R,5R,7R,7aR)-2-(4-chloroanilino)-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carbonyl]piperidine-4-carboxamide.
| Compound Name | 1-[(3aR,4R,5R,7R,7aR)-2-(4-chloroanilino)-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 163176713 |
| Molecular Formula | C20H25ClN4O4S |
| Molecular Weight | 452.96 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 1-[(3aR,4R,5R,7R,7aR)-2-(4-chloroanilino)-4,5-dihydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole-7-carbonyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)[C@H]2C[C@@H](O)[C@H](O)[C@H]3N=C(Nc4ccc(Cl)cc4)S[C@@H]32)CC1 |
| InChI | InChI=1S/C20H25ClN4O4S/c21-11-1-3-12(4-2-11)23-20-24-15-16(27)14(26)9-13(17(15)30-20)19(29)25-7-5-10(6-8-25)18(22)28/h1-4,10,13-17,26-27H,5-9H2,(H2,22,28)(H,23,24)/t13-,14+,15+,16-,17+/m0/s1 |
| InChIKey | XNWBNFGWLGZWKD-JZAWBGDQSA-N |
| XLogP | 1.06 |
| TPSA | 128.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.96 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |