C23H35NO8 — CID 163125685
5-oxo-3-[3,5,14-trihydroxy-10-[[hydroxy(oxido)azaniumyl]oxymethyl]-13-methyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2H-furan (PubChem CID 163125685) has the molecular formula C23H35NO8 and a molecular weight of 453.53 g/mol. Its IUPAC name is 5-oxo-3-[3,5,14-trihydroxy-10-[[hydroxy(oxido)azaniumyl]oxymethyl]-13-methyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2H-furan.
| Compound Name | 5-oxo-3-[3,5,14-trihydroxy-10-[[hydroxy(oxido)azaniumyl]oxymethyl]-13-methyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2H-furan |
|---|---|
| PubChem CID | 163125685 |
| Molecular Formula | C23H35NO8 |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 5-oxo-3-[3,5,14-trihydroxy-10-[[hydroxy(oxido)azaniumyl]oxymethyl]-13-methyl-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2H-furan |
| SMILES | CC12CCC3C(CCC4(O)CC(O)CCC34CO[NH+]([O-])O)C1(O)CCC2C1=CC(=O)OC1 |
| InChI | InChI=1S/C23H35NO8/c1-20-6-3-17-18(23(20,28)9-5-16(20)14-10-19(26)31-12-14)4-8-22(27)11-15(25)2-7-21(17,22)13-32-24(29)30/h10,15-18,24-25,27-29H,2-9,11-13H2,1H3 |
| InChIKey | DFCGIKWIFKIDGY-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 143.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|